![[ICO]](/icons/blank.gif){kind=icon}
![[DIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| :2eDS_Store | 17-Dec-2009 12:11 | 15K | |
| Document2.pdf | 31-Aug-2011 12:43 | 45K | |
| FarSideCownCar.gif | 05-Dec-2007 10:11 | 36K | |
| For WAD structure day/ | 13-Apr-2004 06:34 | - | |
| Hercules.jpg | 24-Apr-2007 06:15 | 49K | |
| MediterraneanSundance.m4a | 30-Oct-2006 12:59 | 11M | |
| REVISED key to the mysterious marginalia.doc | 13-Feb-2004 06:25 | 160K | |
| Results of the Preliminary Writing Exam.doc | 04-Sep-2006 15:38 | 119K | |
| S2400032.JPG | 01-Feb-2006 11:12 | 443K | |
| S2400033.JPG | 01-Feb-2006 11:12 | 398K | |
| S2400034.JPG | 01-Feb-2006 11:12 | 501K | |
| S2400035.JPG | 01-Feb-2006 11:12 | 593K | |
| S2400036.JPG | 29-Jan-2006 10:22 | 273K | |
| S2400037.JPG | 29-Jan-2006 10:23 | 288K | |
| S2400038.JPG | 29-Jan-2006 10:25 | 312K | |
| S2400039.JPG | 29-Jan-2006 10:26 | 336K | |
| S2400040.JPG | 01-Feb-2006 11:13 | 515K | |
| S2400041.JPG | 29-Jan-2006 10:31 | 360K | |
| VAAS Program.pdf | 11-Apr-2012 07:27 | 253K | |
| WrightMorris.jpg | 27-Aug-2009 16:22 | 83K | |
| Writing and the Teaching of Writing.pdf | 18-Jan-2011 15:30 | 59K | |
| _baks/ | 05-Sep-2003 10:16 | - | |
| _mm/ | 25-Nov-2006 08:05 | - | |
| _notes/ | 12-Jan-2004 14:24 | - | |
| batman.jpg | 17-Jan-2012 17:06 | 50K | |
| batman.pdf | 02-Oct-2007 10:27 | 115K | |
| bigdog.jpg | 23-Apr-2007 14:34 | 79K | |
| blocks04_files/ | 08-Apr-2004 10:08 | - | |
| bondposter.jpg | 18-Aug-2011 12:01 | 114K | |
| countycartlinear2004.png | 06-Nov-2008 05:59 | 111K | |
| countycartpurple2008.png | 06-Nov-2008 06:00 | 129K | |
| countymaplinear2004.png | 06-Nov-2008 05:58 | 111K | |
| countymappurple2008.png | 06-Nov-2008 06:00 | 159K | |
| courses/ | 01-Sep-2009 17:36 | - | |
| crime opening assignment.pdf | 31-Aug-2010 16:40 | 79K | |
| dis-abs.htm | 15-Jul-1998 08:11 | 25K | |
| dis-cv.htm | 29-Jul-1998 11:40 | 4.0K | |
| doc2.htm | 23-May-2001 06:35 | 2.2K | |
| doc4.htm | 23-May-2001 06:32 | 2.2K | |
| doc4_files/ | 23-May-2001 06:33 | - | |
| essay.jpg | 27-Aug-2009 15:42 | 32K | |
| examresults.htm | 16-Jan-2006 12:18 | 14K | |
| examresults.pdf | 17-Jan-2011 13:14 | 31K | |
| fairytale.jpg | 30-Aug-2009 14:11 | 154K | |
| familypics/ | 07-Jul-2009 11:30 | - | |
| fear opening assignment.pdf | 31-Aug-2010 16:39 | 76K | |
| firstwriting.pdf | 05-Sep-2007 10:12 | 64K | |
| fitness_stuff.pdf | 22-Nov-2008 14:16 | 143K | |
| fitnessequip.htm | 01-Feb-2006 11:32 | 1.2K | |
| gonzo.jpg | 19-Aug-2009 11:08 | 16K | |
| goodbadugly.mp3 | 07-Nov-2007 09:12 | 582K | |
| gorzelany.pdf | 13-Feb-2009 10:09 | 38K | |
| hours.doc | 20-Sep-2006 07:09 | 61K | |
| hours.pdf | 20-Sep-2006 07:05 | 46K | |
| hrs.html | 09-Sep-2003 11:05 | 46K | |
| itsspring.mp3 | 01-Apr-2008 08:11 | 4.8M | |
| kenyon.pdf | 18-Aug-2011 09:48 | 158K | |
| listfall09.pdf | 02-Sep-2009 16:03 | 44K | |
| listsfall10.pdf | 01-Sep-2010 18:26 | 38K | |
| modern_times.jpg | 15-Jan-2009 11:21 | 265K | |
| mooney.htm | 09-Nov-2005 08:27 | 1.4K | |
| ncha.jpg | 07-Oct-2010 07:04 | 133K | |
| nwa.doc | 31-Oct-2007 08:21 | 74K | |
| offhours.htm | 19-Aug-2009 09:29 | 263 | |
| offhours.htm.htm | 19-Aug-2009 09:28 | 263 | |
| office hours.pdf | 20-Jan-2006 12:03 | 44K | |
| onceuponatime2.jpg | 18-Aug-2009 16:28 | 209K | |
| orientationfall06.pdf | 18-Aug-2006 10:53 | 107K | |
| portforms/ | 02-May-2008 11:01 | - | |
| pweresults.doc | 01-Sep-2008 15:48 | 105K | |
| pweresults.htm | 22-Jan-2008 12:09 | 15K | |
| pweresults.pdf | 30-Aug-2010 15:19 | 55K | |
| pweresults/ | 04-Sep-2006 15:43 | - | |
| pweresultsf11.pdf | 31-Aug-2011 12:45 | 45K | |
| recitation feb 04.doc | 20-Feb-2004 05:17 | 34K | |
| results.htm | 30-Aug-2004 17:15 | 77K | |
| revised marginalia key.doc | 13-Feb-2004 06:24 | 49K | |
| rosie1.jpg | 09-Oct-2008 07:13 | 39K | |
| seminarlists.pdf | 03-Sep-2008 12:31 | 59K | |
| sheehy.jpg | 05-Apr-2006 10:14 | 43K | |
| sheehy2.jpg | 31-Oct-2007 09:31 | 24K | |
| shiba1.jpg | 16-Oct-2006 08:04 | 11K | |
| shiba2.jpg | 16-Oct-2006 08:04 | 7.5K | |
| shiba4.jpg | 16-Oct-2006 14:10 | 174K | |
| shiba5.jpg | 16-Oct-2006 14:09 | 8.8K | |
| shiba6.jpg | 16-Oct-2006 14:09 | 5.9K | |
| sources/ | 08-Aug-1998 06:30 | - | |
| spinlocks.JPG | 20-Jan-2011 07:29 | 34K | |
| spring tutorials.doc | 31-Oct-2007 14:25 | 32K | |
| survival/ | 17-Aug-2001 15:10 | - | |
| tester.jpg | 17-Oct-2006 12:50 | 45K | |
| trough.jpg | 22-Oct-2008 06:11 | 64K | |
| tutorhrs.html | 07-Apr-2004 12:37 | 83K | |
| war syllabus spring 2012.pdf | 16-Jan-2012 10:42 | 1.0M | |
| writing/ | 29-Jan-2003 07:26 | - | |
| zorba.jpg | 24-Apr-2007 06:11 | 25K | |
| zorba2.jpg | 24-Apr-2007 06:16 | 19K | |
| ~$vised marginalia key.doc | 13-Feb-2004 06:11 | 162 | |